C20H26N2O4S2 — CID 118238611
6-[methylsulfonyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]pyridine-3-carboxylic acid (PubChem CID 118238611) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 6-[methylsulfonyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]pyridine-3-carboxylic acid.
| Compound Name | 6-[methylsulfonyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118238611 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 6-[methylsulfonyl-(3,4,4,7,7-pentamethyl-5,6-dihydro-1-benzothiophen-2-yl)amino]pyridine-3-carboxylic acid |
| SMILES | Cc1c(N(c2ccc(C(=O)O)cn2)S(C)(=O)=O)sc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C20H26N2O4S2/c1-12-15-16(20(4,5)10-9-19(15,2)3)27-17(12)22(28(6,25)26)14-8-7-13(11-21-14)18(23)24/h7-8,11H,9-10H2,1-6H3,(H,23,24) |
| InChIKey | ICTWOZRKUBUQCJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |