C23H24N2O5S — CID 118238635
5-[[5-(4-carboxyphenyl)-4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl]amino]furan-2-carboxylic acid (PubChem CID 118238635) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 5-[[5-(4-carboxyphenyl)-4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl]amino]furan-2-carboxylic acid.
| Compound Name | 5-[[5-(4-carboxyphenyl)-4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl]amino]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 118238635 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 5-[[5-(4-carboxyphenyl)-4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl]amino]furan-2-carboxylic acid |
| SMILES | CC1(C)CC(c2ccc(C(=O)O)cc2)C(C)(C)c2nc(Nc3ccc(C(=O)O)o3)sc21 |
| InChI | InChI=1S/C23H24N2O5S/c1-22(2)11-14(12-5-7-13(8-6-12)19(26)27)23(3,4)17-18(22)31-21(25-17)24-16-10-9-15(30-16)20(28)29/h5-10,14H,11H2,1-4H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | IUELOZGGJIGDND-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |