C14H18F4O3Si — CID 11823952
(4-ethenyl-2,3,5,6-tetrafluorophenyl)-triethoxysilane (PubChem CID 11823952) has the molecular formula C14H18F4O3Si and a molecular weight of 338.37 g/mol. Its IUPAC name is (4-ethenyl-2,3,5,6-tetrafluorophenyl)-triethoxysilane.
| Compound Name | (4-ethenyl-2,3,5,6-tetrafluorophenyl)-triethoxysilane |
|---|---|
| PubChem CID | 11823952 |
| Molecular Formula | C14H18F4O3Si |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (4-ethenyl-2,3,5,6-tetrafluorophenyl)-triethoxysilane |
| SMILES | C=Cc1c(F)c(F)c([Si](OCC)(OCC)OCC)c(F)c1F |
| InChI | InChI=1S/C14H18F4O3Si/c1-5-9-10(15)12(17)14(13(18)11(9)16)22(19-6-2,20-7-3)21-8-4/h5H,1,6-8H2,2-4H3 |
| InChIKey | QJFKELOSMIAWSA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|