About 6-oxoundecan-5-yl 4-methylbenzenesulfonate
6-oxoundecan-5-yl 4-methylbenzenesulfonate (PubChem CID 11824010) has the molecular formula C18H28O4S
and a molecular weight of 340.48 g/mol. Its IUPAC name is 6-oxoundecan-5-yl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 6-oxoundecan-5-yl 4-methylbenzenesulfonate |
| PubChem CID | 11824010 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 6-oxoundecan-5-yl 4-methylbenzenesulfonate |
| SMILES | CCCCCC(=O)C(CCCC)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H28O4S/c1-4-6-8-9-17(19)18(10-7-5-2)22-23(20,21)16-13-11-15(3)12-14-16/h11-14,18H,4-10H2,1-3H3 |
| InChIKey | ZINMYOQYMHIUFV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 6-oxoundecan-5-yl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxoundecan-5-yl 4-methylbenzenesulfonate?
The IUPAC name of 6-oxoundecan-5-yl 4-methylbenzenesulfonate (CID 11824010) is 6-oxoundecan-5-yl 4-methylbenzenesulfonate.
What is the SMILES notation for 6-oxoundecan-5-yl 4-methylbenzenesulfonate?
The canonical SMILES for 6-oxoundecan-5-yl 4-methylbenzenesulfonate is CCCCCC(=O)C(CCCC)OS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of 6-oxoundecan-5-yl 4-methylbenzenesulfonate?
The InChIKey is ZINMYOQYMHIUFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O4S/c1-4-6-8-9-17(19)18(10-7-5-2)22-23(20,21)16-13-11-15(3)12-14-16/h11-14,18H,4-10H2,1-3H3.
What are the key properties of 6-oxoundecan-5-yl 4-methylbenzenesulfonate?
6-oxoundecan-5-yl 4-methylbenzenesulfonate has a molecular weight of 340.48 g/mol, XLogP of 4.41, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxoundecan-5-yl 4-methylbenzenesulfonate is sourced from PubChem (CID 11824010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).