C12H21N2+ — CID 118240887
4,6-di(propan-2-yl)-1,2,3,6a-tetrahydropyrrolo[3,2-b]pyrrol-4-ium (PubChem CID 118240887) has the molecular formula C12H21N2+ and a molecular weight of 193.31 g/mol. Its IUPAC name is 4,6-di(propan-2-yl)-1,2,3,6a-tetrahydropyrrolo[3,2-b]pyrrol-4-ium.
| Compound Name | 4,6-di(propan-2-yl)-1,2,3,6a-tetrahydropyrrolo[3,2-b]pyrrol-4-ium |
|---|---|
| PubChem CID | 118240887 |
| Molecular Formula | C12H21N2+ |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.17 |
| IUPAC Name | 4,6-di(propan-2-yl)-1,2,3,6a-tetrahydropyrrolo[3,2-b]pyrrol-4-ium |
| SMILES | CC(C)C1=C[N+](C(C)C)=C2CCNC12 |
| InChI | InChI=1S/C12H21N2/c1-8(2)10-7-14(9(3)4)11-5-6-13-12(10)11/h7-9,12-13H,5-6H2,1-4H3/q+1 |
| InChIKey | JAZZVEWRTCKKKJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|