About 5-amino-7,7-dimethyloxepane-2,6-dione
5-amino-7,7-dimethyloxepane-2,6-dione (PubChem CID 118241040) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 5-amino-7,7-dimethyloxepane-2,6-dione.
Molecular Properties
| Compound Name | 5-amino-7,7-dimethyloxepane-2,6-dione |
| PubChem CID | 118241040 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 5-amino-7,7-dimethyloxepane-2,6-dione |
| SMILES | CC1(C)OC(=O)CCC(N)C1=O |
| InChI | InChI=1S/C8H13NO3/c1-8(2)7(11)5(9)3-4-6(10)12-8/h5H,3-4,9H2,1-2H3 |
| InChIKey | KZEARUKQXTXFMK-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-7,7-dimethyloxepane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-7,7-dimethyloxepane-2,6-dione?
The IUPAC name of 5-amino-7,7-dimethyloxepane-2,6-dione (CID 118241040) is 5-amino-7,7-dimethyloxepane-2,6-dione.
What is the SMILES notation for 5-amino-7,7-dimethyloxepane-2,6-dione?
The canonical SMILES for 5-amino-7,7-dimethyloxepane-2,6-dione is CC1(C)OC(=O)CCC(N)C1=O.
What is the InChIKey of 5-amino-7,7-dimethyloxepane-2,6-dione?
The InChIKey is KZEARUKQXTXFMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-8(2)7(11)5(9)3-4-6(10)12-8/h5H,3-4,9H2,1-2H3.
What are the key properties of 5-amino-7,7-dimethyloxepane-2,6-dione?
5-amino-7,7-dimethyloxepane-2,6-dione has a molecular weight of 171.20 g/mol, XLogP of -0.00, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-7,7-dimethyloxepane-2,6-dione is sourced from PubChem (CID 118241040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).