C22H19ClF2N4O — CID 118241204
3-[2-chloro-5-(4,4-difluorocyclohexyl)oxyphenyl]-7-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 118241204) has the molecular formula C22H19ClF2N4O and a molecular weight of 428.87 g/mol. Its IUPAC name is 3-[2-chloro-5-(4,4-difluorocyclohexyl)oxyphenyl]-7-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-[2-chloro-5-(4,4-difluorocyclohexyl)oxyphenyl]-7-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 118241204 |
| Molecular Formula | C22H19ClF2N4O |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 3-[2-chloro-5-(4,4-difluorocyclohexyl)oxyphenyl]-7-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | Cc1nc2cccnc2n2c(-c3cc(OC4CCC(F)(F)CC4)ccc3Cl)ncc12 |
| InChI | InChI=1S/C22H19ClF2N4O/c1-13-19-12-27-20(29(19)21-18(28-13)3-2-10-26-21)16-11-15(4-5-17(16)23)30-14-6-8-22(24,25)9-7-14/h2-5,10-12,14H,6-9H2,1H3 |
| InChIKey | PJTSUXAURKFBOK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |