C23H21ClF2N4O — CID 118241209
3-[2-chloro-5-(4,4-difluorocyclohexyl)oxyphenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 118241209) has the molecular formula C23H21ClF2N4O and a molecular weight of 442.90 g/mol. Its IUPAC name is 3-[2-chloro-5-(4,4-difluorocyclohexyl)oxyphenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-[2-chloro-5-(4,4-difluorocyclohexyl)oxyphenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 118241209 |
| Molecular Formula | C23H21ClF2N4O |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-[2-chloro-5-(4,4-difluorocyclohexyl)oxyphenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | Cc1ccc2nc(C)c3cnc(-c4cc(OC5CCC(F)(F)CC5)ccc4Cl)n3c2n1 |
| InChI | InChI=1S/C23H21ClF2N4O/c1-13-3-6-19-22(28-13)30-20(14(2)29-19)12-27-21(30)17-11-16(4-5-18(17)24)31-15-7-9-23(25,26)10-8-15/h3-6,11-12,15H,7-10H2,1-2H3 |
| InChIKey | WAEJROVXJMKRCA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |