C21H18ClF3N4O2 — CID 118241222
3-[2-chloro-5-[3-(trifluoromethoxy)propoxy]phenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 118241222) has the molecular formula C21H18ClF3N4O2 and a molecular weight of 450.85 g/mol. Its IUPAC name is 3-[2-chloro-5-[3-(trifluoromethoxy)propoxy]phenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-[2-chloro-5-[3-(trifluoromethoxy)propoxy]phenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 118241222 |
| Molecular Formula | C21H18ClF3N4O2 |
| Molecular Weight | 450.85 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-[2-chloro-5-[3-(trifluoromethoxy)propoxy]phenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | Cc1ccc2nc(C)c3cnc(-c4cc(OCCCOC(F)(F)F)ccc4Cl)n3c2n1 |
| InChI | InChI=1S/C21H18ClF3N4O2/c1-12-4-7-17-20(27-12)29-18(13(2)28-17)11-26-19(29)15-10-14(5-6-16(15)22)30-8-3-9-31-21(23,24)25/h4-7,10-11H,3,8-9H2,1-2H3 |
| InChIKey | MLUVTKZXIYEGBG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|