C20H16ClF3N4O — CID 118241229
3-[2-chloro-5-(3,3,3-trifluoropropoxy)phenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 118241229) has the molecular formula C20H16ClF3N4O and a molecular weight of 420.82 g/mol. Its IUPAC name is 3-[2-chloro-5-(3,3,3-trifluoropropoxy)phenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-[2-chloro-5-(3,3,3-trifluoropropoxy)phenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 118241229 |
| Molecular Formula | C20H16ClF3N4O |
| Molecular Weight | 420.82 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 3-[2-chloro-5-(3,3,3-trifluoropropoxy)phenyl]-7,12-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | Cc1ccc2nc(C)c3cnc(-c4cc(OCCC(F)(F)F)ccc4Cl)n3c2n1 |
| InChI | InChI=1S/C20H16ClF3N4O/c1-11-3-6-16-19(26-11)28-17(12(2)27-16)10-25-18(28)14-9-13(4-5-15(14)21)29-8-7-20(22,23)24/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | GPOILEZOECFBAK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.82 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |