C16H24O6S — CID 11824127
(3R,4R,5R)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol (PubChem CID 11824127) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is (3R,4R,5R)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol.
| Compound Name | (3R,4R,5R)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol |
|---|---|
| PubChem CID | 11824127 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (3R,4R,5R)-2-(benzenesulfonylmethyl)-5-(dimethoxymethyl)-3,4-dimethyloxolan-2-ol |
| SMILES | COC(OC)[C@@H]1OC(O)(CS(=O)(=O)c2ccccc2)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C16H24O6S/c1-11-12(2)16(17,22-14(11)15(20-3)21-4)10-23(18,19)13-8-6-5-7-9-13/h5-9,11-12,14-15,17H,10H2,1-4H3/t11-,12-,14-,16?/m1/s1 |
| InChIKey | UBEZJAANWILGGG-XMCAMDJDSA-N |
| XLogP | 1.44 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|