C10H22N4O3S — CID 118241711
N-(4-azido-3,3-dimethyl-2-propan-2-yloxybutyl)methanesulfonamide (PubChem CID 118241711) has the molecular formula C10H22N4O3S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-(4-azido-3,3-dimethyl-2-propan-2-yloxybutyl)methanesulfonamide.
| Compound Name | N-(4-azido-3,3-dimethyl-2-propan-2-yloxybutyl)methanesulfonamide |
|---|---|
| PubChem CID | 118241711 |
| Molecular Formula | C10H22N4O3S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-(4-azido-3,3-dimethyl-2-propan-2-yloxybutyl)methanesulfonamide |
| SMILES | CC(C)OC(CNS(C)(=O)=O)C(C)(C)CN=[N+]=[N-] |
| InChI | InChI=1S/C10H22N4O3S/c1-8(2)17-9(6-13-18(5,15)16)10(3,4)7-12-14-11/h8-9,13H,6-7H2,1-5H3 |
| InChIKey | RGCLMLKPQSNVRZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|