About N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide
N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide (PubChem CID 118241947) has the molecular formula C14H29F3N2O2S
and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide |
| PubChem CID | 118241947 |
| Molecular Formula | C14H29F3N2O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide |
| SMILES | CCC(C)(CC(C)CN(C(C)C)C(F)(F)F)N(C)S(C)(=O)=O |
| InChI | InChI=1S/C14H29F3N2O2S/c1-8-13(5,18(6)22(7,20)21)9-12(4)10-19(11(2)3)14(15,16)17/h11-12H,8-10H2,1-7H3 |
| InChIKey | XJVHOJZDINRWHM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide?
The IUPAC name of N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide (CID 118241947) is N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide is CCC(C)(CC(C)CN(C(C)C)C(F)(F)F)N(C)S(C)(=O)=O.
What is the InChIKey of N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide?
The InChIKey is XJVHOJZDINRWHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29F3N2O2S/c1-8-13(5,18(6)22(7,20)21)9-12(4)10-19(11(2)3)14(15,16)17/h11-12H,8-10H2,1-7H3.
What are the key properties of N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide?
N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide has a molecular weight of 346.46 g/mol, XLogP of 3.30, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-dimethyl-6-[propan-2-yl(trifluoromethyl)amino]hexan-3-yl]-N-methylmethanesulfonamide is sourced from PubChem (CID 118241947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).