C13H16BrF5 — CID 11824196
(3R,5S)-1-(2-bromo-3,3,3-trifluoropropyl)-3,5-difluoroadamantane (PubChem CID 11824196) has the molecular formula C13H16BrF5 and a molecular weight of 347.17 g/mol. Its IUPAC name is (3R,5S)-1-(2-bromo-3,3,3-trifluoropropyl)-3,5-difluoroadamantane.
| Compound Name | (3R,5S)-1-(2-bromo-3,3,3-trifluoropropyl)-3,5-difluoroadamantane |
|---|---|
| PubChem CID | 11824196 |
| Molecular Formula | C13H16BrF5 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (3R,5S)-1-(2-bromo-3,3,3-trifluoropropyl)-3,5-difluoroadamantane |
| SMILES | FC(F)(F)C(Br)CC12CC3C[C@@](F)(C1)C[C@](F)(C3)C2 |
| InChI | InChI=1S/C13H16BrF5/c14-9(13(17,18)19)4-10-1-8-2-11(15,5-10)7-12(16,3-8)6-10/h8-9H,1-7H2/t8?,9?,10?,11-,12+ |
| InChIKey | OAPLEPCASRUJRI-PSTKUWSXSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|