C15H17N5O5 — CID 11824204
2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate (PubChem CID 11824204) has the molecular formula C15H17N5O5 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate.
| Compound Name | 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate |
|---|---|
| PubChem CID | 11824204 |
| Molecular Formula | C15H17N5O5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate |
| SMILES | O=C(CN1CCCn2c1nc1ccccc1c2=O)NCCO[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N5O5/c21-13(16-6-9-25-20(23)24)10-18-7-3-8-19-14(22)11-4-1-2-5-12(11)17-15(18)19/h1-2,4-5H,3,6-10H2,(H,16,21) |
| InChIKey | QWFRXVYRIXPPIE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|