About 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate
2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate (PubChem CID 11824204) has the molecular formula C15H17N5O5
and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate.
Molecular Properties
| Compound Name | 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate |
| PubChem CID | 11824204 |
| Molecular Formula | C15H17N5O5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate |
| SMILES | O=C(CN1CCCn2c1nc1ccccc1c2=O)NCCO[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N5O5/c21-13(16-6-9-25-20(23)24)10-18-7-3-8-19-14(22)11-4-1-2-5-12(11)17-15(18)19/h1-2,4-5H,3,6-10H2,(H,16,21) |
| InChIKey | QWFRXVYRIXPPIE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate?
The IUPAC name of 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate (CID 11824204) is 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate.
What is the SMILES notation for 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate?
The canonical SMILES for 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate is O=C(CN1CCCn2c1nc1ccccc1c2=O)NCCO[N+](=O)[O-].
What is the InChIKey of 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate?
The InChIKey is QWFRXVYRIXPPIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O5/c21-13(16-6-9-25-20(23)24)10-18-7-3-8-19-14(22)11-4-1-2-5-12(11)17-15(18)19/h1-2,4-5H,3,6-10H2,(H,16,21).
What are the key properties of 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate?
2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate has a molecular weight of 347.33 g/mol, XLogP of -0.07, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-1-yl)acetyl]amino]ethyl nitrate is sourced from PubChem (CID 11824204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).