About 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one
6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one (PubChem CID 118242075) has the molecular formula C5H8FN3O
and a molecular weight of 145.14 g/mol. Its IUPAC name is 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one |
| PubChem CID | 118242075 |
| Molecular Formula | C5H8FN3O |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one |
| SMILES | CN1C=C(F)C(N)NC1=O |
| InChI | InChI=1S/C5H8FN3O/c1-9-2-3(6)4(7)8-5(9)10/h2,4H,7H2,1H3,(H,8,10) |
| InChIKey | VKPPPXDBHVIZHO-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one?
The IUPAC name of 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one (CID 118242075) is 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one is CN1C=C(F)C(N)NC1=O.
What is the InChIKey of 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one?
The InChIKey is VKPPPXDBHVIZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN3O/c1-9-2-3(6)4(7)8-5(9)10/h2,4H,7H2,1H3,(H,8,10).
What are the key properties of 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one?
6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one has a molecular weight of 145.14 g/mol, XLogP of -0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-fluoro-3-methyl-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 118242075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).