About [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate
[(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate (PubChem CID 118242220) has the molecular formula C9H12FNO2
and a molecular weight of 185.20 g/mol. Its IUPAC name is [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate |
| PubChem CID | 118242220 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1=CC[C@H](F)C=C1 |
| InChI | InChI=1S/C9H12FNO2/c1-2-11-9(12)13-8-5-3-7(10)4-6-8/h3,5-7H,2,4H2,1H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | LNIMSMQIEWRLMS-SSDOTTSWSA-N |
| XLogP | 1.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate?
The IUPAC name of [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate (CID 118242220) is [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate.
What is the SMILES notation for [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate?
The canonical SMILES for [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate is CCNC(=O)OC1=CC[C@H](F)C=C1.
What is the InChIKey of [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate?
The InChIKey is LNIMSMQIEWRLMS-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H12FNO2/c1-2-11-9(12)13-8-5-3-7(10)4-6-8/h3,5-7H,2,4H2,1H3,(H,11,12)/t7-/m1/s1.
What are the key properties of [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate?
[(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate has a molecular weight of 185.20 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-4-fluorocyclohexa-1,5-dien-1-yl] N-ethylcarbamate is sourced from PubChem (CID 118242220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).