C14H24N10O2 — CID 118242303
2,4-bis(aminodiazenyl)-5-(5-hydrazinyl-4-methoxy-2-propan-2-ylphenoxy)-1,2,3,4-tetrahydropyrimidine (PubChem CID 118242303) has the molecular formula C14H24N10O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2,4-bis(aminodiazenyl)-5-(5-hydrazinyl-4-methoxy-2-propan-2-ylphenoxy)-1,2,3,4-tetrahydropyrimidine.
| Compound Name | 2,4-bis(aminodiazenyl)-5-(5-hydrazinyl-4-methoxy-2-propan-2-ylphenoxy)-1,2,3,4-tetrahydropyrimidine |
|---|---|
| PubChem CID | 118242303 |
| Molecular Formula | C14H24N10O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 2,4-bis(aminodiazenyl)-5-(5-hydrazinyl-4-methoxy-2-propan-2-ylphenoxy)-1,2,3,4-tetrahydropyrimidine |
| SMILES | COc1cc(C(C)C)c(OC2=CNC(N=NN)NC2N=NN)cc1NN |
| InChI | InChI=1S/C14H24N10O2/c1-7(2)8-4-11(25-3)9(20-15)5-10(8)26-12-6-18-14(22-24-17)19-13(12)21-23-16/h4-7,13-14,18-20H,15H2,1-3H3,(H2,16,21)(H2,17,22) |
| InChIKey | VCNFVAMFHXOJKA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|