C19H26N4O2 — CID 118242497
5-[(3R)-3-hydroxypyrrolidin-1-yl]-1-methyl-N-(6-tricyclo[5.2.1.04,8]dec-3-enyl)pyrazole-4-carboxamide (PubChem CID 118242497) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 5-[(3R)-3-hydroxypyrrolidin-1-yl]-1-methyl-N-(6-tricyclo[5.2.1.04,8]dec-3-enyl)pyrazole-4-carboxamide.
| Compound Name | 5-[(3R)-3-hydroxypyrrolidin-1-yl]-1-methyl-N-(6-tricyclo[5.2.1.04,8]dec-3-enyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118242497 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 5-[(3R)-3-hydroxypyrrolidin-1-yl]-1-methyl-N-(6-tricyclo[5.2.1.04,8]dec-3-enyl)pyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NC2CC3=CCC4CC3C2C4)c1N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C19H26N4O2/c1-22-19(23-5-4-13(24)10-23)16(9-20-22)18(25)21-17-8-12-3-2-11-6-14(12)15(17)7-11/h3,9,11,13-15,17,24H,2,4-8,10H2,1H3,(H,21,25)/t11?,13-,14?,15?,17?/m1/s1 |
| InChIKey | JUQKNPDPEPEOTF-WBTMDNOWSA-N |
| XLogP | 1.47 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|