(2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid

C8H11NO2 — CID 118242599

IUPAC(2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid
SMILESC/C=C\C=C(/C=N/C)C(=O)O
InChIInChI=1S/C8H11NO2/c1-3-4-5-7(6-9-2)8(10)11/h3-6H,1-2H3,(H,10,11)/b4-3-,7-5+,9-6+
InChIKeyKONWFIQRNOHIMJ-SNIIRKHRSA-N
MW153.18 g/mol
LogP1.27
Rot. Bonds3

About (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid

(2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid (PubChem CID 118242599) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid
PubChem CID118242599
Molecular FormulaC8H11NO2
Molecular Weight153.18 g/mol
Exact Mass153.08
IUPAC Name(2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid
SMILESC/C=C\C=C(/C=N/C)C(=O)O
InChIInChI=1S/C8H11NO2/c1-3-4-5-7(6-9-2)8(10)11/h3-6H,1-2H3,(H,10,11)/b4-3-,7-5+,9-6+
InChIKeyKONWFIQRNOHIMJ-SNIIRKHRSA-N
XLogP1.27
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.18
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid?
The IUPAC name of (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid (CID 118242599) is (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid.
What is the SMILES notation for (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid?
The canonical SMILES for (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid is C/C=C\C=C(/C=N/C)C(=O)O.
What is the InChIKey of (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid?
The InChIKey is KONWFIQRNOHIMJ-SNIIRKHRSA-N. The full InChI is InChI=1S/C8H11NO2/c1-3-4-5-7(6-9-2)8(10)11/h3-6H,1-2H3,(H,10,11)/b4-3-,7-5+,9-6+.
What are the key properties of (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid?
(2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid has a molecular weight of 153.18 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-2-(methyliminomethyl)hexa-2,4-dienoic acid is sourced from PubChem (CID 118242599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).