C30H25FN4O3S — CID 118242607
N-[(11aS)-11-fluoro-2,2-dioxo-1,3,4,6,11,11a-hexahydro-[1,4]thiazino[4,3-b]isoquinolin-9-yl]-4-methyl-3-(2-quinazolin-5-ylethynyl)benzamide (PubChem CID 118242607) has the molecular formula C30H25FN4O3S and a molecular weight of 540.62 g/mol. Its IUPAC name is N-[(11aS)-11-fluoro-2,2-dioxo-1,3,4,6,11,11a-hexahydro-[1,4]thiazino[4,3-b]isoquinolin-9-yl]-4-methyl-3-(2-quinazolin-5-ylethynyl)benzamide.
| Compound Name | N-[(11aS)-11-fluoro-2,2-dioxo-1,3,4,6,11,11a-hexahydro-[1,4]thiazino[4,3-b]isoquinolin-9-yl]-4-methyl-3-(2-quinazolin-5-ylethynyl)benzamide |
|---|---|
| PubChem CID | 118242607 |
| Molecular Formula | C30H25FN4O3S |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-[(11aS)-11-fluoro-2,2-dioxo-1,3,4,6,11,11a-hexahydro-[1,4]thiazino[4,3-b]isoquinolin-9-yl]-4-methyl-3-(2-quinazolin-5-ylethynyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3c(c2)C(F)[C@H]2CS(=O)(=O)CCN2C3)cc1C#Cc1cccc2ncncc12 |
| InChI | InChI=1S/C30H25FN4O3S/c1-19-5-6-22(13-21(19)8-7-20-3-2-4-27-26(20)15-32-18-33-27)30(36)34-24-10-9-23-16-35-11-12-39(37,38)17-28(35)29(31)25(23)14-24/h2-6,9-10,13-15,18,28-29H,11-12,16-17H2,1H3,(H,34,36)/t28-,29?/m1/s1 |
| InChIKey | NILAVEQGXMFARU-FICMROCWSA-N |
| XLogP | 4.21 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|