About 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene
6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene (PubChem CID 118242739) has the molecular formula C20H38O
and a molecular weight of 294.52 g/mol. Its IUPAC name is 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene.
Molecular Properties
| Compound Name | 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene |
| PubChem CID | 118242739 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene |
| SMILES | CCC(C)C1C=CC(CCC(C)(C)C)C(OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H38O/c1-9-15(2)17-11-10-16(12-13-19(3,4)5)18(14-17)21-20(6,7)8/h10-11,15-18H,9,12-14H2,1-8H3 |
| InChIKey | NRDQTNITDKGFMG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene?
The IUPAC name of 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene (CID 118242739) is 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene.
What is the SMILES notation for 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene?
The canonical SMILES for 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene is CCC(C)C1C=CC(CCC(C)(C)C)C(OC(C)(C)C)C1.
What is the InChIKey of 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene?
The InChIKey is NRDQTNITDKGFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O/c1-9-15(2)17-11-10-16(12-13-19(3,4)5)18(14-17)21-20(6,7)8/h10-11,15-18H,9,12-14H2,1-8H3.
What are the key properties of 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene?
6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene has a molecular weight of 294.52 g/mol, XLogP of 6.23, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butan-2-yl-3-(3,3-dimethylbutyl)-4-[(2-methylpropan-2-yl)oxy]cyclohexene is sourced from PubChem (CID 118242739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).