C25H19NO — CID 11824276
(1R,3S,5R,6R)-4-oxo-1,3,6-triphenylbicyclo[3.1.0]hexane-3-carbonitrile (PubChem CID 11824276) has the molecular formula C25H19NO and a molecular weight of 349.43 g/mol. Its IUPAC name is (1R,3S,5R,6R)-4-oxo-1,3,6-triphenylbicyclo[3.1.0]hexane-3-carbonitrile.
| Compound Name | (1R,3S,5R,6R)-4-oxo-1,3,6-triphenylbicyclo[3.1.0]hexane-3-carbonitrile |
|---|---|
| PubChem CID | 11824276 |
| Molecular Formula | C25H19NO |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (1R,3S,5R,6R)-4-oxo-1,3,6-triphenylbicyclo[3.1.0]hexane-3-carbonitrile |
| SMILES | N#C[C@@]1(c2ccccc2)C[C@]2(c3ccccc3)[C@H](C1=O)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C25H19NO/c26-17-24(19-12-6-2-7-13-19)16-25(20-14-8-3-9-15-20)21(22(25)23(24)27)18-10-4-1-5-11-18/h1-15,21-22H,16H2/t21-,22-,24+,25+/m0/s1 |
| InChIKey | QGTJRMXDTQKYKH-ZCAIMPEWSA-N |
| XLogP | 4.77 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |