C26H44O3 — CID 118242775
(2R,3S,4R,5S,6S)-4-(methoxymethoxy)-2,3,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexan-1-one (PubChem CID 118242775) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-4-(methoxymethoxy)-2,3,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexan-1-one.
| Compound Name | (2R,3S,4R,5S,6S)-4-(methoxymethoxy)-2,3,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 118242775 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | (2R,3S,4R,5S,6S)-4-(methoxymethoxy)-2,3,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexan-1-one |
| SMILES | COCO[C@@H]1[C@@H](C)[C@@H](C)C(=O)[C@@H](C)[C@@H]1C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H44O3/c1-18(2)11-9-12-19(3)13-10-14-20(4)15-16-24-23(7)25(27)21(5)22(6)26(24)29-17-28-8/h11,13,15,21-24,26H,9-10,12,14,16-17H2,1-8H3/b19-13+,20-15+/t21-,22+,23+,24+,26-/m1/s1 |
| InChIKey | RYSVDYQHEQCQOD-PNRDHNSXSA-N |
| XLogP | 6.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|