C24H29N5O4 — CID 118243108
4-[2-[3-(methoxymethoxy)phenyl]-7-(morpholin-4-ylmethyl)pyrido[3,2-d]pyrimidin-4-yl]morpholine (PubChem CID 118243108) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is 4-[2-[3-(methoxymethoxy)phenyl]-7-(morpholin-4-ylmethyl)pyrido[3,2-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-[3-(methoxymethoxy)phenyl]-7-(morpholin-4-ylmethyl)pyrido[3,2-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 118243108 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 4-[2-[3-(methoxymethoxy)phenyl]-7-(morpholin-4-ylmethyl)pyrido[3,2-d]pyrimidin-4-yl]morpholine |
| SMILES | COCOc1cccc(-c2nc(N3CCOCC3)c3ncc(CN4CCOCC4)cc3n2)c1 |
| InChI | InChI=1S/C24H29N5O4/c1-30-17-33-20-4-2-3-19(14-20)23-26-21-13-18(16-28-5-9-31-10-6-28)15-25-22(21)24(27-23)29-7-11-32-12-8-29/h2-4,13-15H,5-12,16-17H2,1H3 |
| InChIKey | QHYYMEVPFRBOFU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 82.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|