C16H11Cl2NO4 — CID 11824327
2,5-dichloro-3-(5,6-dimethoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 11824327) has the molecular formula C16H11Cl2NO4 and a molecular weight of 352.17 g/mol. Its IUPAC name is 2,5-dichloro-3-(5,6-dimethoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dichloro-3-(5,6-dimethoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11824327 |
| Molecular Formula | C16H11Cl2NO4 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 2,5-dichloro-3-(5,6-dimethoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1cc2[nH]cc(C3=C(Cl)C(=O)C=C(Cl)C3=O)c2cc1OC |
| InChI | InChI=1S/C16H11Cl2NO4/c1-22-12-3-7-8(6-19-10(7)5-13(12)23-2)14-15(18)11(20)4-9(17)16(14)21/h3-6,19H,1-2H3 |
| InChIKey | RXOUBKPTHIOXNY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|