C44H29N5 — CID 118243317
6-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-5H-indeno[1,2-d]pyrimidine (PubChem CID 118243317) has the molecular formula C44H29N5 and a molecular weight of 627.75 g/mol. Its IUPAC name is 6-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-5H-indeno[1,2-d]pyrimidine.
| Compound Name | 6-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-5H-indeno[1,2-d]pyrimidine |
|---|---|
| PubChem CID | 118243317 |
| Molecular Formula | C44H29N5 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | 6-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-5H-indeno[1,2-d]pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc(-c5cccc6c5Cc5cncnc5-6)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C44H29N5/c1-3-9-29(10-4-1)31-17-21-33(22-18-31)42-47-43(34-23-19-32(20-24-34)30-11-5-2-6-12-30)49-44(48-42)36-14-7-13-35(25-36)38-15-8-16-39-40(38)26-37-27-45-28-46-41(37)39/h1-25,27-28H,26H2 |
| InChIKey | HVGJUQWCNBODJE-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |