C25H25N3O5 — CID 118243499
2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-(4-morpholin-4-ylphenyl)-1H-indole-3-carbonitrile (PubChem CID 118243499) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-(4-morpholin-4-ylphenyl)-1H-indole-3-carbonitrile.
| Compound Name | 2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-(4-morpholin-4-ylphenyl)-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 118243499 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-(4-morpholin-4-ylphenyl)-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)[nH]c2ccc(-c3ccc(N4CCOCC4)cc3)cc12 |
| InChI | InChI=1S/C25H25N3O5/c26-12-19-18-11-16(15-1-4-17(5-2-15)28-7-9-30-10-8-28)3-6-20(18)27-25(19)33-22-14-32-23-21(29)13-31-24(22)23/h1-6,11,21-24,27,29H,7-10,13-14H2/t21-,22-,23-,24-/m1/s1 |
| InChIKey | QBPFUAWEKXMKPD-MOUTVQLLSA-N |
| XLogP | 2.45 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |