C26H28N2O6 — CID 118243537
4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohexane-1-carboxylic acid (PubChem CID 118243537) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118243537 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(c2ccc(-c3ccc4[nH]c(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)cc4n3)cc2)CC1 |
| InChI | InChI=1S/C26H28N2O6/c29-21-12-32-25-22(13-33-24(21)25)34-23-11-20-19(28-23)10-9-18(27-20)16-5-1-14(2-6-16)15-3-7-17(8-4-15)26(30)31/h1-2,5-6,9-11,15,17,21-22,24-25,28-29H,3-4,7-8,12-13H2,(H,30,31)/t15?,17?,21-,22-,24-,25-/m1/s1 |
| InChIKey | VPDGLHBQTXZPDK-YCCOOALPSA-N |
| XLogP | 3.49 |
| TPSA | 113.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |