C23H22ClF2N3O5 — CID 118243542
(3R,3aR,6R,6aR)-6-[[6-chloro-5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118243542) has the molecular formula C23H22ClF2N3O5 and a molecular weight of 493.89 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118243542 |
| Molecular Formula | C23H22ClF2N3O5 |
| Molecular Weight | 493.89 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-(2,6-difluoro-4-morpholin-4-ylphenyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1cc2nc(-c3c(F)cc(N4CCOCC4)cc3F)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C23H22ClF2N3O5/c24-12-7-15-16(8-19(27-15)34-18-10-33-22-17(30)9-32-23(18)22)28-21(12)20-13(25)5-11(6-14(20)26)29-1-3-31-4-2-29/h5-8,17-18,22-23,27,30H,1-4,9-10H2/t17-,18-,22-,23-/m1/s1 |
| InChIKey | ZYZCLGBASOQVFY-DPZOUVDISA-N |
| XLogP | 2.90 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |