About 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine
2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine (PubChem CID 118243574) has the molecular formula C12H29N5
and a molecular weight of 243.40 g/mol. Its IUPAC name is 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine |
| PubChem CID | 118243574 |
| Molecular Formula | C12H29N5 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.24 |
| IUPAC Name | 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine |
| SMILES | CCN(CC)NCCN1CCN(CCN)CC1 |
| InChI | InChI=1S/C12H29N5/c1-3-17(4-2)14-6-8-16-11-9-15(7-5-13)10-12-16/h14H,3-13H2,1-2H3 |
| InChIKey | RTLBUOWNKAWPLZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine?
The IUPAC name of 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine (CID 118243574) is 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine.
What is the SMILES notation for 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine?
The canonical SMILES for 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine is CCN(CC)NCCN1CCN(CCN)CC1.
What is the InChIKey of 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine?
The InChIKey is RTLBUOWNKAWPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H29N5/c1-3-17(4-2)14-6-8-16-11-9-15(7-5-13)10-12-16/h14H,3-13H2,1-2H3.
What are the key properties of 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine?
2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine has a molecular weight of 243.40 g/mol, XLogP of -0.59, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(2,2-diethylhydrazinyl)ethyl]piperazin-1-yl]ethanamine is sourced from PubChem (CID 118243574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).