C24H28N2O5S — CID 118243753
5-[4-(1,1-dihydroxyethyl)-N-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)anilino]furan-2-carboxylic acid (PubChem CID 118243753) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is 5-[4-(1,1-dihydroxyethyl)-N-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)anilino]furan-2-carboxylic acid.
| Compound Name | 5-[4-(1,1-dihydroxyethyl)-N-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)anilino]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 118243753 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 5-[4-(1,1-dihydroxyethyl)-N-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)anilino]furan-2-carboxylic acid |
| SMILES | CC(O)(O)c1ccc(N(c2ccc(C(=O)O)o2)c2nc3c(s2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C24H28N2O5S/c1-22(2)12-13-23(3,4)19-18(22)25-21(32-19)26(17-11-10-16(31-17)20(27)28)15-8-6-14(7-9-15)24(5,29)30/h6-11,29-30H,12-13H2,1-5H3,(H,27,28) |
| InChIKey | NSGIEDBRZWAJJV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|