C41H42F2N2S3 — CID 118244454
4-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-5,6-difluoro-7-(5-methylthiophen-2-yl)-2,1,3-benzothiadiazole (PubChem CID 118244454) has the molecular formula C41H42F2N2S3 and a molecular weight of 697.00 g/mol. Its IUPAC name is 4-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-5,6-difluoro-7-(5-methylthiophen-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-5,6-difluoro-7-(5-methylthiophen-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 118244454 |
| Molecular Formula | C41H42F2N2S3 |
| Molecular Weight | 697.00 g/mol |
| Exact Mass | 696.25 |
| IUPAC Name | 4-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-5,6-difluoro-7-(5-methylthiophen-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4c(F)c(F)c(-c5ccc(C)s5)c5nsnc45)s3)cc21 |
| InChI | InChI=1S/C41H42F2N2S3/c1-5-7-9-11-21-41(22-12-10-8-6-2)30-23-25(3)13-16-28(30)29-17-15-27(24-31(29)41)32-19-20-34(47-32)36-38(43)37(42)35(33-18-14-26(4)46-33)39-40(36)45-48-44-39/h13-20,23-24H,5-12,21-22H2,1-4H3 |
| InChIKey | APDVWPQYVBYJRA-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.00 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|