C34H49N5O8 — CID 118244494
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoylamino]propanoyl]piperazine-1-carboxylate (PubChem CID 118244494) has the molecular formula C34H49N5O8 and a molecular weight of 655.79 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoylamino]propanoyl]piperazine-1-carboxylate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoylamino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118244494 |
| Molecular Formula | C34H49N5O8 |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.36 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoylamino]propanoyl]piperazine-1-carboxylate |
| SMILES | COCCOCCOCCNC(=O)NCCC(=O)N1CCN(C(=O)ONC(=O)Cc2ccc(CCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C34H49N5O8/c1-44-23-24-46-26-25-45-22-17-36-33(42)35-16-15-32(41)38-18-20-39(21-19-38)34(43)47-37-31(40)27-30-13-11-29(12-14-30)10-6-5-9-28-7-3-2-4-8-28/h2-4,7-8,11-14H,5-6,9-10,15-27H2,1H3,(H,37,40)(H2,35,36,42) |
| InChIKey | JUJMYRCIACAOSA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 147.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|