C6H12N4OS — CID 118244877
5-[2-methoxyethyl(methyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 118244877) has the molecular formula C6H12N4OS and a molecular weight of 188.26 g/mol. Its IUPAC name is 5-[2-methoxyethyl(methyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[2-methoxyethyl(methyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 118244877 |
| Molecular Formula | C6H12N4OS |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 5-[2-methoxyethyl(methyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | COCCN(C)c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C6H12N4OS/c1-10(3-4-11-2)5-7-6(12)9-8-5/h3-4H2,1-2H3,(H2,7,8,9,12) |
| InChIKey | KLWCNNUNFZHTGP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 56.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|