C6H12N4S — CID 118244959
5-[methyl(propan-2-yl)amino]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 118244959) has the molecular formula C6H12N4S and a molecular weight of 172.26 g/mol. Its IUPAC name is 5-[methyl(propan-2-yl)amino]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[methyl(propan-2-yl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 118244959 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 5-[methyl(propan-2-yl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CC(C)N(C)c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C6H12N4S/c1-4(2)10(3)5-7-6(11)9-8-5/h4H,1-3H3,(H2,7,8,9,11) |
| InChIKey | SNEMNFOAKZJEDW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|