C7H14N4S — CID 118244982
5-[methyl(2-methylpropyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 118244982) has the molecular formula C7H14N4S and a molecular weight of 186.28 g/mol. Its IUPAC name is 5-[methyl(2-methylpropyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[methyl(2-methylpropyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 118244982 |
| Molecular Formula | C7H14N4S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 5-[methyl(2-methylpropyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CC(C)CN(C)c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C7H14N4S/c1-5(2)4-11(3)6-8-7(12)10-9-6/h5H,4H2,1-3H3,(H2,8,9,10,12) |
| InChIKey | BAFIAZMSQZPNJT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|