About N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine
N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine (PubChem CID 118244996) has the molecular formula C6H12FN5
and a molecular weight of 173.19 g/mol. Its IUPAC name is N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine |
| PubChem CID | 118244996 |
| Molecular Formula | C6H12FN5 |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCN)c1n[nH]nc1F |
| InChI | InChI=1S/C6H12FN5/c1-12(4-2-3-8)6-5(7)9-11-10-6/h2-4,8H2,1H3,(H,9,10,11) |
| InChIKey | CHLIIEMXDYTGAC-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine?
The IUPAC name of N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine (CID 118244996) is N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine is CN(CCCN)c1n[nH]nc1F.
What is the InChIKey of N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine?
The InChIKey is CHLIIEMXDYTGAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FN5/c1-12(4-2-3-8)6-5(7)9-11-10-6/h2-4,8H2,1H3,(H,9,10,11).
What are the key properties of N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine?
N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine has a molecular weight of 173.19 g/mol, XLogP of -0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-fluoro-2H-triazol-4-yl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 118244996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).