C11H19NO — CID 118245174
1-(4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-yl)-N-methylpropan-2-amine (PubChem CID 118245174) has the molecular formula C11H19NO and a molecular weight of 187.23 g/mol. Its IUPAC name is 1-(4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-yl)-N-methylpropan-2-amine.
| Compound Name | 1-(4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-yl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 118245174 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 1-(4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-yl)-N-methylpropan-2-amine |
| SMILES | CNC(C)C[13CH]1[13CH]=[13CH][13C](OC)=[13CH][13CH2]1 |
| InChI | InChI=1S/C11H19NO/c1-9(12-2)8-10-4-6-11(13-3)7-5-10/h4,6-7,9-10,12H,5,8H2,1-3H3/i4+1,5+1,6+1,7+1,10+1,11+1 |
| InChIKey | XHTCXJAWNOOUKG-VSDRCFRXSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |