About 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one
1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one (PubChem CID 118245177) has the molecular formula C10H12O3
and a molecular weight of 186.16 g/mol. Its IUPAC name is 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one |
| PubChem CID | 118245177 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one |
| SMILES | CC(=O)C[13C]1=[13CH][13CH]=[13C]2OCO[13CH]2[13CH2]1 |
| InChI | InChI=1S/C10H12O3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,10H,4-6H2,1H3/i2+1,3+1,5+1,8+1,9+1,10+1 |
| InChIKey | VUJPYECRAOKCIU-GBDAEYFOSA-N |
| XLogP | 1.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one?
The IUPAC name of 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one (CID 118245177) is 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one.
What is the SMILES notation for 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one?
The canonical SMILES for 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one is CC(=O)C[13C]1=[13CH][13CH]=[13C]2OCO[13CH]2[13CH2]1.
What is the InChIKey of 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one?
The InChIKey is VUJPYECRAOKCIU-GBDAEYFOSA-N. The full InChI is InChI=1S/C10H12O3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,10H,4-6H2,1H3/i2+1,3+1,5+1,8+1,9+1,10+1.
What are the key properties of 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one?
1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one has a molecular weight of 186.16 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3a,4-dihydro-1,3-benzodioxol-5-yl)propan-2-one is sourced from PubChem (CID 118245177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).