C10H17NO — CID 118245185
1-(4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-yl)propan-2-amine (PubChem CID 118245185) has the molecular formula C10H17NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 1-(4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-yl)propan-2-amine.
| Compound Name | 1-(4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 118245185 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 1-(4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-2,4-dien-1-yl)propan-2-amine |
| SMILES | CO[13C]1=[13CH][13CH2][13CH](CC(C)N)[13CH]=[13CH]1 |
| InChI | InChI=1S/C10H17NO/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3,5-6,8-9H,4,7,11H2,1-2H3/i3+1,4+1,5+1,6+1,9+1,10+1 |
| InChIKey | LFMKCCQDWRNEIH-MSQIWANRSA-N |
| XLogP | 1.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |