About (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal
(2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal (PubChem CID 11824558) has the molecular formula C18H40O3Si2
and a molecular weight of 360.69 g/mol. Its IUPAC name is (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal.
Molecular Properties
| Compound Name | (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal |
| PubChem CID | 11824558 |
| Molecular Formula | C18H40O3Si2 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H40O3Si2/c1-17(2,3)22(7,8)20-14-12-11-13-16(15-19)21-23(9,10)18(4,5)6/h15-16H,11-14H2,1-10H3/t16-/m0/s1 |
| InChIKey | LYWXIKSANLVKHH-INIZCTEOSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal?
The IUPAC name of (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal (CID 11824558) is (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal.
What is the SMILES notation for (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal?
The canonical SMILES for (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal is CC(C)(C)[Si](C)(C)OCCCC[C@@H](C=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal?
The InChIKey is LYWXIKSANLVKHH-INIZCTEOSA-N. The full InChI is InChI=1S/C18H40O3Si2/c1-17(2,3)22(7,8)20-14-12-11-13-16(15-19)21-23(9,10)18(4,5)6/h15-16H,11-14H2,1-10H3/t16-/m0/s1.
What are the key properties of (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal?
(2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal has a molecular weight of 360.69 g/mol, XLogP of 5.77, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexanal is sourced from PubChem (CID 11824558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).