C55H35N7O — CID 118245956
8-(5-dibenzofuran-2-yl-4a,9b-dihydropyrido[4,3-b]indol-8-yl)-4,12-bis(5-phenyl-3-pyridinyl)-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 118245956) has the molecular formula C55H35N7O and a molecular weight of 809.93 g/mol. Its IUPAC name is 8-(5-dibenzofuran-2-yl-4a,9b-dihydropyrido[4,3-b]indol-8-yl)-4,12-bis(5-phenyl-3-pyridinyl)-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-(5-dibenzofuran-2-yl-4a,9b-dihydropyrido[4,3-b]indol-8-yl)-4,12-bis(5-phenyl-3-pyridinyl)-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 118245956 |
| Molecular Formula | C55H35N7O |
| Molecular Weight | 809.93 g/mol |
| Exact Mass | 809.29 |
| IUPAC Name | 8-(5-dibenzofuran-2-yl-4a,9b-dihydropyrido[4,3-b]indol-8-yl)-4,12-bis(5-phenyl-3-pyridinyl)-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | C1=CC2C(C=N1)c1cc(-n3c4ccc(-c5cncc(-c6ccccc6)c5)nc4c4nc(-c5cncc(-c6ccccc6)c5)ccc43)ccc1N2c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C55H35N7O/c1-3-9-34(10-4-1)36-25-38(31-57-29-36)46-17-20-50-54(59-46)55-51(21-18-47(60-55)39-26-37(30-58-32-39)35-11-5-2-6-12-35)62(50)40-15-19-48-43(27-40)45-33-56-24-23-49(45)61(48)41-16-22-53-44(28-41)42-13-7-8-14-52(42)63-53/h1-33,45,49H |
| InChIKey | YIDVVUQPCGQWGU-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 85.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.93 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |