C20H22N6O2 — CID 118246257
N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-8-oxa-2,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine (PubChem CID 118246257) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-8-oxa-2,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine.
| Compound Name | N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-8-oxa-2,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine |
|---|---|
| PubChem CID | 118246257 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-8-oxa-2,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine |
| SMILES | COc1cc(Nc2ncc3c(n2)N2CCCC2CO3)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C20H22N6O2/c1-13-10-25(12-22-13)16-6-5-14(8-17(16)27-2)23-20-21-9-18-19(24-20)26-7-3-4-15(26)11-28-18/h5-6,8-10,12,15H,3-4,7,11H2,1-2H3,(H,21,23,24) |
| InChIKey | IFZRGDQHASNZET-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |