C9H8ClF2N3O — CID 118246281
(6S)-12-chloro-4,4-difluoro-8-oxa-2,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene (PubChem CID 118246281) has the molecular formula C9H8ClF2N3O and a molecular weight of 247.63 g/mol. Its IUPAC name is (6S)-12-chloro-4,4-difluoro-8-oxa-2,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene.
| Compound Name | (6S)-12-chloro-4,4-difluoro-8-oxa-2,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 118246281 |
| Molecular Formula | C9H8ClF2N3O |
| Molecular Weight | 247.63 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | (6S)-12-chloro-4,4-difluoro-8-oxa-2,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
| SMILES | FC1(F)C[C@H]2COc3cnc(Cl)nc3N2C1 |
| InChI | InChI=1S/C9H8ClF2N3O/c10-8-13-2-6-7(14-8)15-4-9(11,12)1-5(15)3-16-6/h2,5H,1,3-4H2/t5-/m0/s1 |
| InChIKey | VHCUJKHGTPPQFS-YFKPBYRVSA-N |
| XLogP | 1.74 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |