C21H33NO4 — CID 11824631
[(5R,8S,8aR)-5-[(E)-dodec-2-enyl]-3-oxo-1,5,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-8-yl] acetate (PubChem CID 11824631) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is [(5R,8S,8aR)-5-[(E)-dodec-2-enyl]-3-oxo-1,5,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-8-yl] acetate.
| Compound Name | [(5R,8S,8aR)-5-[(E)-dodec-2-enyl]-3-oxo-1,5,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-8-yl] acetate |
|---|---|
| PubChem CID | 11824631 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | [(5R,8S,8aR)-5-[(E)-dodec-2-enyl]-3-oxo-1,5,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-8-yl] acetate |
| SMILES | CCCCCCCCC/C=C/C[C@@H]1C=C[C@H](OC(C)=O)[C@H]2COC(=O)N21 |
| InChI | InChI=1S/C21H33NO4/c1-3-4-5-6-7-8-9-10-11-12-13-18-14-15-20(26-17(2)23)19-16-25-21(24)22(18)19/h11-12,14-15,18-20H,3-10,13,16H2,1-2H3/b12-11+/t18-,19-,20+/m1/s1 |
| InChIKey | YKDYGEISYFSNDV-BZSGXQBDSA-N |
| XLogP | 4.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|