C23H21ClN2O2 — CID 118246932
N-[(1R)-2-amino-2-oxo-1-phenylethyl]-2-chloro-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 118246932) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-[(1R)-2-amino-2-oxo-1-phenylethyl]-2-chloro-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | N-[(1R)-2-amino-2-oxo-1-phenylethyl]-2-chloro-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 118246932 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[(1R)-2-amino-2-oxo-1-phenylethyl]-2-chloro-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@H](c1ccccc1)N(C(=O)c1ccccc1Cl)[C@@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C23H21ClN2O2/c1-16(17-10-4-2-5-11-17)26(23(28)19-14-8-9-15-20(19)24)21(22(25)27)18-12-6-3-7-13-18/h2-16,21H,1H3,(H2,25,27)/t16-,21-/m1/s1 |
| InChIKey | QQEODPRCIZDJSJ-IIBYNOLFSA-N |
| XLogP | 4.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |