C25H21NO2 — CID 11824737
1-[(1R,8S,9S,12R)-1,8-diphenyl-13-oxa-10-azatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-trien-10-yl]ethanone (PubChem CID 11824737) has the molecular formula C25H21NO2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[(1R,8S,9S,12R)-1,8-diphenyl-13-oxa-10-azatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-trien-10-yl]ethanone.
| Compound Name | 1-[(1R,8S,9S,12R)-1,8-diphenyl-13-oxa-10-azatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-trien-10-yl]ethanone |
|---|---|
| PubChem CID | 11824737 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-[(1R,8S,9S,12R)-1,8-diphenyl-13-oxa-10-azatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-trien-10-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H]2[C@H]1[C@@]1(c3ccccc3)O[C@]2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H21NO2/c1-17(27)26-16-22-23(26)25(19-12-6-3-7-13-19)21-15-9-8-14-20(21)24(22,28-25)18-10-4-2-5-11-18/h2-15,22-23H,16H2,1H3/t22-,23+,24-,25+/m1/s1 |
| InChIKey | QHUDKWZSRQKUJQ-RCTAOEEJSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |