C20H33NO3S — CID 11824746
tert-butyl N-(tert-butylsulfanylmethyl)-N-[(1R,2S)-1-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 11824746) has the molecular formula C20H33NO3S and a molecular weight of 367.56 g/mol. Its IUPAC name is tert-butyl N-(tert-butylsulfanylmethyl)-N-[(1R,2S)-1-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-(tert-butylsulfanylmethyl)-N-[(1R,2S)-1-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11824746 |
| Molecular Formula | C20H33NO3S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | tert-butyl N-(tert-butylsulfanylmethyl)-N-[(1R,2S)-1-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC[C@@H]([C@H](O)c1ccccc1)N(CSC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO3S/c1-8-16(17(22)15-12-10-9-11-13-15)21(14-25-20(5,6)7)18(23)24-19(2,3)4/h9-13,16-17,22H,8,14H2,1-7H3/t16-,17+/m0/s1 |
| InChIKey | LPTWZOHKIJFFTR-DLBZAZTESA-N |
| XLogP | 5.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|