About 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate
1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118247667) has the molecular formula C13H9Cl2F3N2O5
and a molecular weight of 401.12 g/mol. Its IUPAC name is 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| PubChem CID | 118247667 |
| Molecular Formula | C13H9Cl2F3N2O5 |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(ONN=O)OC(=O)C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C13H9Cl2F3N2O5/c1-5(25-20-19-22)23-12(21)8-3-6-2-7(14)4-9(15)10(6)24-11(8)13(16,17)18/h2-5,11H,1H3,(H,20,22)/t5?,11-/m0/s1 |
| InChIKey | BDXNWHAVKOTTAY-ZOHDFZEYSA-N |
| XLogP | 3.79 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The IUPAC name of 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (CID 118247667) is 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
What is the SMILES notation for 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The canonical SMILES for 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate is CC(ONN=O)OC(=O)C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F.
What is the InChIKey of 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The InChIKey is BDXNWHAVKOTTAY-ZOHDFZEYSA-N. The full InChI is InChI=1S/C13H9Cl2F3N2O5/c1-5(25-20-19-22)23-12(21)8-3-6-2-7(14)4-9(15)10(6)24-11(8)13(16,17)18/h2-5,11H,1H3,(H,20,22)/t5?,11-/m0/s1.
What are the key properties of 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate has a molecular weight of 401.12 g/mol, XLogP of 3.79, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-oxohydrazinyl)oxyethyl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate is sourced from PubChem (CID 118247667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).